C19H23NO11 — CID 176621821
[(2R,3R,4S,5R,6S)-4,5-diacetyloxy-6-[4-(hydroxymethyl)-3-nitrophenoxy]-2-methyloxan-3-yl] acetate (PubChem CID 176621821) has the molecular formula C19H23NO11 and a molecular weight of 441.39 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-4,5-diacetyloxy-6-[4-(hydroxymethyl)-3-nitrophenoxy]-2-methyloxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-4,5-diacetyloxy-6-[4-(hydroxymethyl)-3-nitrophenoxy]-2-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 176621821 |
| Molecular Formula | C19H23NO11 |
| Molecular Weight | 441.39 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-4,5-diacetyloxy-6-[4-(hydroxymethyl)-3-nitrophenoxy]-2-methyloxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](Oc2ccc(CO)c([N+](=O)[O-])c2)O[C@H](C)[C@H]1OC(C)=O |
| InChI | InChI=1S/C19H23NO11/c1-9-16(28-10(2)22)17(29-11(3)23)18(30-12(4)24)19(27-9)31-14-6-5-13(8-21)15(7-14)20(25)26/h5-7,9,16-19,21H,8H2,1-4H3/t9-,16-,17+,18-,19+/m1/s1 |
| InChIKey | COJDXEBQAUOLBH-UVICMKTJSA-N |
| XLogP | 1.01 |
| TPSA | 160.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.39 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|