C18H22N2O9 — CID 121371655
[1-(4,5-dimethoxy-2-nitrophenyl)-3-methylbutyl] (2,5-dioxopyrrolidin-1-yl) carbonate (PubChem CID 121371655) has the molecular formula C18H22N2O9 and a molecular weight of 410.38 g/mol. Its IUPAC name is [1-(4,5-dimethoxy-2-nitrophenyl)-3-methylbutyl] (2,5-dioxopyrrolidin-1-yl) carbonate.
| Compound Name | [1-(4,5-dimethoxy-2-nitrophenyl)-3-methylbutyl] (2,5-dioxopyrrolidin-1-yl) carbonate |
|---|---|
| PubChem CID | 121371655 |
| Molecular Formula | C18H22N2O9 |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | [1-(4,5-dimethoxy-2-nitrophenyl)-3-methylbutyl] (2,5-dioxopyrrolidin-1-yl) carbonate |
| SMILES | COc1cc(C(CC(C)C)OC(=O)ON2C(=O)CCC2=O)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C18H22N2O9/c1-10(2)7-13(28-18(23)29-19-16(21)5-6-17(19)22)11-8-14(26-3)15(27-4)9-12(11)20(24)25/h8-10,13H,5-7H2,1-4H3 |
| InChIKey | ZCLGYGLMHSIPDF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 134.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|