C14H21NO5 — CID 83008622
1-(4,5-dimethoxy-2-nitrophenyl)-4-methylpentan-2-ol (PubChem CID 83008622) has the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. Its IUPAC name is 1-(4,5-dimethoxy-2-nitrophenyl)-4-methylpentan-2-ol.
| Compound Name | 1-(4,5-dimethoxy-2-nitrophenyl)-4-methylpentan-2-ol |
|---|---|
| PubChem CID | 83008622 |
| Molecular Formula | C14H21NO5 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 1-(4,5-dimethoxy-2-nitrophenyl)-4-methylpentan-2-ol |
| SMILES | COc1cc(CC(O)CC(C)C)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C14H21NO5/c1-9(2)5-11(16)6-10-7-13(19-3)14(20-4)8-12(10)15(17)18/h7-9,11,16H,5-6H2,1-4H3 |
| InChIKey | CNWGQGIYKLDTKW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|