C15H25N2O6P — CID 70979475
(4,5-dimethoxy-2-nitrophenyl)methoxy-N,N-di(propan-2-yl)phosphonamidous acid (PubChem CID 70979475) has the molecular formula C15H25N2O6P and a molecular weight of 360.35 g/mol. Its IUPAC name is (4,5-dimethoxy-2-nitrophenyl)methoxy-N,N-di(propan-2-yl)phosphonamidous acid.
| Compound Name | (4,5-dimethoxy-2-nitrophenyl)methoxy-N,N-di(propan-2-yl)phosphonamidous acid |
|---|---|
| PubChem CID | 70979475 |
| Molecular Formula | C15H25N2O6P |
| Molecular Weight | 360.35 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | (4,5-dimethoxy-2-nitrophenyl)methoxy-N,N-di(propan-2-yl)phosphonamidous acid |
| SMILES | COc1cc(CO[P@](O)N(C(C)C)C(C)C)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C15H25N2O6P/c1-10(2)16(11(3)4)24(20)23-9-12-7-14(21-5)15(22-6)8-13(12)17(18)19/h7-8,10-11,20H,9H2,1-6H3/t24-/m0/s1 |
| InChIKey | PGFWAGXHCHWUDI-DEOSSOPVSA-N |
| XLogP | 3.47 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|