C13H20N2O4 — CID 83007872
1-(4,5-dimethoxy-2-nitrophenyl)-N-methylbutan-2-amine (PubChem CID 83007872) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is 1-(4,5-dimethoxy-2-nitrophenyl)-N-methylbutan-2-amine.
| Compound Name | 1-(4,5-dimethoxy-2-nitrophenyl)-N-methylbutan-2-amine |
|---|---|
| PubChem CID | 83007872 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 1-(4,5-dimethoxy-2-nitrophenyl)-N-methylbutan-2-amine |
| SMILES | CCC(Cc1cc(OC)c(OC)cc1[N+](=O)[O-])NC |
| InChI | InChI=1S/C13H20N2O4/c1-5-10(14-2)6-9-7-12(18-3)13(19-4)8-11(9)15(16)17/h7-8,10,14H,5-6H2,1-4H3 |
| InChIKey | AGBQUKVQVQEAMB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|