C30H40N2O14 — CID 157433599
(2,5-dioxopyrrolidin-1-yl) 1-[5-methoxy-2-nitro-4-[4-oxo-7-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]heptoxy]phenyl]ethyl carbonate (PubChem CID 157433599) has the molecular formula C30H40N2O14 and a molecular weight of 652.65 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 1-[5-methoxy-2-nitro-4-[4-oxo-7-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]heptoxy]phenyl]ethyl carbonate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 1-[5-methoxy-2-nitro-4-[4-oxo-7-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]heptoxy]phenyl]ethyl carbonate |
|---|---|
| PubChem CID | 157433599 |
| Molecular Formula | C30H40N2O14 |
| Molecular Weight | 652.65 g/mol |
| Exact Mass | 652.25 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 1-[5-methoxy-2-nitro-4-[4-oxo-7-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]heptoxy]phenyl]ethyl carbonate |
| SMILES | C#CCOCCOCCOCCOCCCC(=O)CCCOc1cc([N+](=O)[O-])c(C(C)OC(=O)ON2C(=O)CCC2=O)cc1OC |
| InChI | InChI=1S/C30H40N2O14/c1-4-11-40-14-16-42-18-19-43-17-15-41-12-5-7-23(33)8-6-13-44-27-21-25(32(37)38)24(20-26(27)39-3)22(2)45-30(36)46-31-28(34)9-10-29(31)35/h1,20-22H,5-19H2,2-3H3 |
| InChIKey | VXHAXTPZUQPWDC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 188.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.65 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|