C24H26N4O15S — CID 122593375
1-[1-[4-[4-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-4-oxobutoxy]-5-methoxy-2-nitrophenyl]ethoxycarbonyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid (PubChem CID 122593375) has the molecular formula C24H26N4O15S and a molecular weight of 642.55 g/mol. Its IUPAC name is 1-[1-[4-[4-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-4-oxobutoxy]-5-methoxy-2-nitrophenyl]ethoxycarbonyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid.
| Compound Name | 1-[1-[4-[4-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-4-oxobutoxy]-5-methoxy-2-nitrophenyl]ethoxycarbonyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid |
|---|---|
| PubChem CID | 122593375 |
| Molecular Formula | C24H26N4O15S |
| Molecular Weight | 642.55 g/mol |
| Exact Mass | 642.11 |
| IUPAC Name | 1-[1-[4-[4-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-4-oxobutoxy]-5-methoxy-2-nitrophenyl]ethoxycarbonyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid |
| SMILES | COc1cc(C(C)OC(=O)ON2C(=O)CC(S(=O)(=O)O)C2=O)c([N+](=O)[O-])cc1OCCCC(=O)NCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C24H26N4O15S/c1-13(42-24(34)43-27-22(32)12-18(23(27)33)44(37,38)39)14-10-16(40-2)17(11-15(14)28(35)36)41-9-3-4-19(29)25-7-8-26-20(30)5-6-21(26)31/h5-6,10-11,13,18H,3-4,7-9,12H2,1-2H3,(H,25,29)(H,37,38,39) |
| InChIKey | HBDBYHXRMCZWQN-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 255.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.55 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|