C32H50N4O10 — CID 178093800
1-[4-[4-[2-[6-(2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)hexanoylamino]ethylamino]-4-oxobutoxy]-5-methoxy-2-nitrophenyl]ethyl acetate;ethane (PubChem CID 178093800) has the molecular formula C32H50N4O10 and a molecular weight of 650.77 g/mol. Its IUPAC name is 1-[4-[4-[2-[6-(2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)hexanoylamino]ethylamino]-4-oxobutoxy]-5-methoxy-2-nitrophenyl]ethyl acetate;ethane.
| Compound Name | 1-[4-[4-[2-[6-(2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)hexanoylamino]ethylamino]-4-oxobutoxy]-5-methoxy-2-nitrophenyl]ethyl acetate;ethane |
|---|---|
| PubChem CID | 178093800 |
| Molecular Formula | C32H50N4O10 |
| Molecular Weight | 650.77 g/mol |
| Exact Mass | 650.35 |
| IUPAC Name | 1-[4-[4-[2-[6-(2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)hexanoylamino]ethylamino]-4-oxobutoxy]-5-methoxy-2-nitrophenyl]ethyl acetate;ethane |
| SMILES | CC.COc1cc(C(C)OC(C)=O)c([N+](=O)[O-])cc1OCCCC(=O)NCCNC(=O)CCCCCN1C(=O)CC(C(C)C)C1=O |
| InChI | InChI=1S/C30H44N4O10.C2H6/c1-19(2)22-17-29(38)33(30(22)39)14-8-6-7-10-27(36)31-12-13-32-28(37)11-9-15-43-26-18-24(34(40)41)23(16-25(26)42-5)20(3)44-21(4)35;1-2/h16,18-20,22H,6-15,17H2,1-5H3,(H,31,36)(H,32,37);1-2H3 |
| InChIKey | LLYIQWYMHCKXMT-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 183.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.77 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|