C16H23N3O7 — CID 166938665
1-[5-methoxy-4-[4-(methylamino)-4-oxobutoxy]-2-nitrophenyl]ethyl N-methylcarbamate (PubChem CID 166938665) has the molecular formula C16H23N3O7 and a molecular weight of 369.37 g/mol. Its IUPAC name is 1-[5-methoxy-4-[4-(methylamino)-4-oxobutoxy]-2-nitrophenyl]ethyl N-methylcarbamate.
| Compound Name | 1-[5-methoxy-4-[4-(methylamino)-4-oxobutoxy]-2-nitrophenyl]ethyl N-methylcarbamate |
|---|---|
| PubChem CID | 166938665 |
| Molecular Formula | C16H23N3O7 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 1-[5-methoxy-4-[4-(methylamino)-4-oxobutoxy]-2-nitrophenyl]ethyl N-methylcarbamate |
| SMILES | CNC(=O)CCCOc1cc([N+](=O)[O-])c(C(C)OC(=O)NC)cc1OC |
| InChI | InChI=1S/C16H23N3O7/c1-10(26-16(21)18-3)11-8-13(24-4)14(9-12(11)19(22)23)25-7-5-6-15(20)17-2/h8-10H,5-7H2,1-4H3,(H,17,20)(H,18,21) |
| InChIKey | ILTXJCZPDHGZKW-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|