C23H29NO11 — CID 89330290
2-[1-[4-(5-hydroxy-4-oxo-6-prop-2-enoyloxyhexoxy)-5-methoxy-2-nitrophenyl]ethoxy]ethyl prop-2-enoate (PubChem CID 89330290) has the molecular formula C23H29NO11 and a molecular weight of 495.48 g/mol. Its IUPAC name is 2-[1-[4-(5-hydroxy-4-oxo-6-prop-2-enoyloxyhexoxy)-5-methoxy-2-nitrophenyl]ethoxy]ethyl prop-2-enoate.
| Compound Name | 2-[1-[4-(5-hydroxy-4-oxo-6-prop-2-enoyloxyhexoxy)-5-methoxy-2-nitrophenyl]ethoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 89330290 |
| Molecular Formula | C23H29NO11 |
| Molecular Weight | 495.48 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | 2-[1-[4-(5-hydroxy-4-oxo-6-prop-2-enoyloxyhexoxy)-5-methoxy-2-nitrophenyl]ethoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOC(C)c1cc(OC)c(OCCCC(=O)C(O)COC(=O)C=C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H29NO11/c1-5-22(27)34-11-10-32-15(3)16-12-20(31-4)21(13-17(16)24(29)30)33-9-7-8-18(25)19(26)14-35-23(28)6-2/h5-6,12-13,15,19,26H,1-2,7-11,14H2,3-4H3 |
| InChIKey | FIYQPWDELZKUHR-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 160.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.48 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|