C32H36N2O14 — CID 172972730
2-[4-[4-nitro-3-(1-prop-2-enoyloxyethyl)phenoxy]butanoyloxy]ethyl 4-[4-nitro-3-(1-prop-2-enoyloxyethyl)phenoxy]butanoate (PubChem CID 172972730) has the molecular formula C32H36N2O14 and a molecular weight of 672.64 g/mol. Its IUPAC name is 2-[4-[4-nitro-3-(1-prop-2-enoyloxyethyl)phenoxy]butanoyloxy]ethyl 4-[4-nitro-3-(1-prop-2-enoyloxyethyl)phenoxy]butanoate.
| Compound Name | 2-[4-[4-nitro-3-(1-prop-2-enoyloxyethyl)phenoxy]butanoyloxy]ethyl 4-[4-nitro-3-(1-prop-2-enoyloxyethyl)phenoxy]butanoate |
|---|---|
| PubChem CID | 172972730 |
| Molecular Formula | C32H36N2O14 |
| Molecular Weight | 672.64 g/mol |
| Exact Mass | 672.22 |
| IUPAC Name | 2-[4-[4-nitro-3-(1-prop-2-enoyloxyethyl)phenoxy]butanoyloxy]ethyl 4-[4-nitro-3-(1-prop-2-enoyloxyethyl)phenoxy]butanoate |
| SMILES | C=CC(=O)OC(C)c1cc(OCCCC(=O)OCCOC(=O)CCCOc2ccc([N+](=O)[O-])c(C(C)OC(=O)C=C)c2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C32H36N2O14/c1-5-29(35)47-21(3)25-19-23(11-13-27(25)33(39)40)43-15-7-9-31(37)45-17-18-46-32(38)10-8-16-44-24-12-14-28(34(41)42)26(20-24)22(4)48-30(36)6-2/h5-6,11-14,19-22H,1-2,7-10,15-18H2,3-4H3 |
| InChIKey | OZRBXVCGKQGQEU-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 209.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.64 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|