About methane;1-[2-nitro-5-(3-oxobutyl)phenyl]ethyl propanoate
methane;1-[2-nitro-5-(3-oxobutyl)phenyl]ethyl propanoate (PubChem CID 167576311) has the molecular formula C16H23NO5
and a molecular weight of 309.36 g/mol. Its IUPAC name is methane;1-[2-nitro-5-(3-oxobutyl)phenyl]ethyl propanoate.
Molecular Properties
| Compound Name | methane;1-[2-nitro-5-(3-oxobutyl)phenyl]ethyl propanoate |
| PubChem CID | 167576311 |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | methane;1-[2-nitro-5-(3-oxobutyl)phenyl]ethyl propanoate |
| SMILES | C.CCC(=O)OC(C)c1cc(CCC(C)=O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H19NO5.CH4/c1-4-15(18)21-11(3)13-9-12(6-5-10(2)17)7-8-14(13)16(19)20;/h7-9,11H,4-6H2,1-3H3;1H4 |
| InChIKey | GOUAWSJOFLXDSX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methane;1-[2-nitro-5-(3-oxobutyl)phenyl]ethyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;1-[2-nitro-5-(3-oxobutyl)phenyl]ethyl propanoate?
The IUPAC name of methane;1-[2-nitro-5-(3-oxobutyl)phenyl]ethyl propanoate (CID 167576311) is methane;1-[2-nitro-5-(3-oxobutyl)phenyl]ethyl propanoate.
What is the SMILES notation for methane;1-[2-nitro-5-(3-oxobutyl)phenyl]ethyl propanoate?
The canonical SMILES for methane;1-[2-nitro-5-(3-oxobutyl)phenyl]ethyl propanoate is C.CCC(=O)OC(C)c1cc(CCC(C)=O)ccc1[N+](=O)[O-].
What is the InChIKey of methane;1-[2-nitro-5-(3-oxobutyl)phenyl]ethyl propanoate?
The InChIKey is GOUAWSJOFLXDSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO5.CH4/c1-4-15(18)21-11(3)13-9-12(6-5-10(2)17)7-8-14(13)16(19)20;/h7-9,11H,4-6H2,1-3H3;1H4.
What are the key properties of methane;1-[2-nitro-5-(3-oxobutyl)phenyl]ethyl propanoate?
methane;1-[2-nitro-5-(3-oxobutyl)phenyl]ethyl propanoate has a molecular weight of 309.36 g/mol, XLogP of 3.77, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methane;1-[2-nitro-5-(3-oxobutyl)phenyl]ethyl propanoate is sourced from PubChem (CID 167576311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).