C20H34N3O5P — CID 135126723
N-[[3-[1-[[di(propan-2-yl)amino]-methoxyphosphanyl]oxyethyl]-4-nitrophenyl]methyl]butanamide (PubChem CID 135126723) has the molecular formula C20H34N3O5P and a molecular weight of 427.48 g/mol. Its IUPAC name is N-[[3-[1-[[di(propan-2-yl)amino]-methoxyphosphanyl]oxyethyl]-4-nitrophenyl]methyl]butanamide.
| Compound Name | N-[[3-[1-[[di(propan-2-yl)amino]-methoxyphosphanyl]oxyethyl]-4-nitrophenyl]methyl]butanamide |
|---|---|
| PubChem CID | 135126723 |
| Molecular Formula | C20H34N3O5P |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | N-[[3-[1-[[di(propan-2-yl)amino]-methoxyphosphanyl]oxyethyl]-4-nitrophenyl]methyl]butanamide |
| SMILES | CCCC(=O)NCc1ccc([N+](=O)[O-])c(C(C)OP(OC)N(C(C)C)C(C)C)c1 |
| InChI | InChI=1S/C20H34N3O5P/c1-8-9-20(24)21-13-17-10-11-19(23(25)26)18(12-17)16(6)28-29(27-7)22(14(2)3)15(4)5/h10-12,14-16H,8-9,13H2,1-7H3,(H,21,24) |
| InChIKey | JRWVLMPQCQYFDV-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|