C15H24BN2O8PS — CID 164565154
CID 164565154 (PubChem CID 164565154) has the molecular formula C15H24BN2O8PS and a molecular weight of 434.22 g/mol.
| Compound Name | CID 164565154 |
|---|---|
| PubChem CID | 164565154 |
| Molecular Formula | C15H24BN2O8PS |
| Molecular Weight | 434.22 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | — |
| SMILES | CC.[B]OCCCC(=O)NCc1ccc([N+](=O)[O-])c(C(C)OP(=O)(O)OS)c1 |
| InChI | InChI=1S/C13H18BN2O8PS.C2H6/c1-9(23-25(20,21)24-26)11-7-10(4-5-12(11)16(18)19)8-15-13(17)3-2-6-22-14;1-2/h4-5,7,9,26H,2-3,6,8H2,1H3,(H,15,17)(H,20,21);1-2H3 |
| InChIKey | HLCAUKRHIJCNCX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 137.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.22 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|