C17H27N2O7P — CID 134393893
methyl 1-[5-[(4-methylhexanoylamino)methyl]-2-nitrophenyl]ethyl hydrogen phosphate (PubChem CID 134393893) has the molecular formula C17H27N2O7P and a molecular weight of 402.38 g/mol. Its IUPAC name is methyl 1-[5-[(4-methylhexanoylamino)methyl]-2-nitrophenyl]ethyl hydrogen phosphate.
| Compound Name | methyl 1-[5-[(4-methylhexanoylamino)methyl]-2-nitrophenyl]ethyl hydrogen phosphate |
|---|---|
| PubChem CID | 134393893 |
| Molecular Formula | C17H27N2O7P |
| Molecular Weight | 402.38 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | methyl 1-[5-[(4-methylhexanoylamino)methyl]-2-nitrophenyl]ethyl hydrogen phosphate |
| SMILES | CCC(C)CCC(=O)NCc1ccc([N+](=O)[O-])c(C(C)OP(=O)(O)OC)c1 |
| InChI | InChI=1S/C17H27N2O7P/c1-5-12(2)6-9-17(20)18-11-14-7-8-16(19(21)22)15(10-14)13(3)26-27(23,24)25-4/h7-8,10,12-13H,5-6,9,11H2,1-4H3,(H,18,20)(H,23,24) |
| InChIKey | LLYFOTSQMZKWEU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|