C32H44N5O11P — CID 162009496
[7-[3-[1-(5-ethyl-4-hydroxyoxolan-2-yl)-2,4-dioxopyrimidin-5-yl]prop-2-ynylamino]-7-oxoheptyl]-[1-[2-nitro-5-[(propanoylamino)methyl]phenyl]ethoxy]phosphinic acid (PubChem CID 162009496) has the molecular formula C32H44N5O11P and a molecular weight of 705.70 g/mol. Its IUPAC name is [7-[3-[1-(5-ethyl-4-hydroxyoxolan-2-yl)-2,4-dioxopyrimidin-5-yl]prop-2-ynylamino]-7-oxoheptyl]-[1-[2-nitro-5-[(propanoylamino)methyl]phenyl]ethoxy]phosphinic acid.
| Compound Name | [7-[3-[1-(5-ethyl-4-hydroxyoxolan-2-yl)-2,4-dioxopyrimidin-5-yl]prop-2-ynylamino]-7-oxoheptyl]-[1-[2-nitro-5-[(propanoylamino)methyl]phenyl]ethoxy]phosphinic acid |
|---|---|
| PubChem CID | 162009496 |
| Molecular Formula | C32H44N5O11P |
| Molecular Weight | 705.70 g/mol |
| Exact Mass | 705.28 |
| IUPAC Name | [7-[3-[1-(5-ethyl-4-hydroxyoxolan-2-yl)-2,4-dioxopyrimidin-5-yl]prop-2-ynylamino]-7-oxoheptyl]-[1-[2-nitro-5-[(propanoylamino)methyl]phenyl]ethoxy]phosphinic acid |
| SMILES | CCC(=O)NCc1ccc([N+](=O)[O-])c(C(C)OP(=O)(O)CCCCCCC(=O)NCC#Cc2cn(C3CC(O)C(CC)O3)c(=O)[nH]c2=O)c1 |
| InChI | InChI=1S/C32H44N5O11P/c1-4-27-26(38)18-30(47-27)36-20-23(31(41)35-32(36)42)11-10-15-33-29(40)12-8-6-7-9-16-49(45,46)48-21(3)24-17-22(19-34-28(39)5-2)13-14-25(24)37(43)44/h13-14,17,20-21,26-27,30,38H,4-9,12,15-16,18-19H2,1-3H3,(H,33,40)(H,34,39)(H,45,46)(H,35,41,42) |
| InChIKey | ISDCOXRHTLMVGR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 232.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.70 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|