C36H39N3O6 — CID 121487437
N-[6-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]hex-5-ynyl]butanamide;4-methylpyrene (PubChem CID 121487437) has the molecular formula C36H39N3O6 and a molecular weight of 609.72 g/mol. Its IUPAC name is N-[6-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]hex-5-ynyl]butanamide;4-methylpyrene.
| Compound Name | N-[6-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]hex-5-ynyl]butanamide;4-methylpyrene |
|---|---|
| PubChem CID | 121487437 |
| Molecular Formula | C36H39N3O6 |
| Molecular Weight | 609.72 g/mol |
| Exact Mass | 609.28 |
| IUPAC Name | N-[6-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]hex-5-ynyl]butanamide;4-methylpyrene |
| SMILES | CCCC(=O)NCCCCC#Cc1cn([C@H]2C[C@H](O)[C@@H](CO)O2)c(=O)[nH]c1=O.Cc1cc2cccc3ccc4cccc1c4c32 |
| InChI | InChI=1S/C19H27N3O6.C17H12/c1-2-7-16(25)20-9-6-4-3-5-8-13-11-22(19(27)21-18(13)26)17-10-14(24)15(12-23)28-17;1-11-10-14-6-2-4-12-8-9-13-5-3-7-15(11)17(13)16(12)14/h11,14-15,17,23-24H,2-4,6-7,9-10,12H2,1H3,(H,20,25)(H,21,26,27);2-10H,1H3/t14-,15+,17+;/m0./s1 |
| InChIKey | MQILRWVDLNMWRL-FFMLRVAQSA-N |
| XLogP | 4.51 |
| TPSA | 133.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.72 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|