C34H43N4O10P — CID 78319233
methyl (2S)-2-[[[(2S,3R,5S)-3-hydroxy-5-[5-[3-(octanoylamino)prop-1-ynyl]-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 78319233) has the molecular formula C34H43N4O10P and a molecular weight of 698.71 g/mol. Its IUPAC name is methyl (2S)-2-[[[(2S,3R,5S)-3-hydroxy-5-[5-[3-(octanoylamino)prop-1-ynyl]-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[[(2S,3R,5S)-3-hydroxy-5-[5-[3-(octanoylamino)prop-1-ynyl]-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 78319233 |
| Molecular Formula | C34H43N4O10P |
| Molecular Weight | 698.71 g/mol |
| Exact Mass | 698.27 |
| IUPAC Name | methyl (2S)-2-[[[(2S,3R,5S)-3-hydroxy-5-[5-[3-(octanoylamino)prop-1-ynyl]-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | CCCCCCCC(=O)NCC#Cc1cn([C@@H]2C[C@@H](O)[C@H](COP(=O)(N[C@@H](C)C(=O)OC)Oc3cccc4ccccc34)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C34H43N4O10P/c1-4-5-6-7-8-18-30(40)35-19-12-15-25-21-38(34(43)36-32(25)41)31-20-27(39)29(47-31)22-46-49(44,37-23(2)33(42)45-3)48-28-17-11-14-24-13-9-10-16-26(24)28/h9-11,13-14,16-17,21,23,27,29,31,39H,4-8,18-20,22H2,1-3H3,(H,35,40)(H,37,44)(H,36,41,43)/t23-,27+,29-,31-,49?/m0/s1 |
| InChIKey | ONBWNLFUHMTAHQ-SROHRGLSSA-N |
| XLogP | 3.52 |
| TPSA | 187.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.71 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|