C30H39FN3O9P — CID 66558061
pentyl (2S)-2-[[[(2R,3S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]-3-methylpentanoate (PubChem CID 66558061) has the molecular formula C30H39FN3O9P and a molecular weight of 635.63 g/mol. Its IUPAC name is pentyl (2S)-2-[[[(2R,3S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]-3-methylpentanoate.
| Compound Name | pentyl (2S)-2-[[[(2R,3S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 66558061 |
| Molecular Formula | C30H39FN3O9P |
| Molecular Weight | 635.63 g/mol |
| Exact Mass | 635.24 |
| IUPAC Name | pentyl (2S)-2-[[[(2R,3S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]-3-methylpentanoate |
| SMILES | CCCCCOC(=O)[C@@H](NP(=O)(OC[C@H]1O[C@@H](n2cc(F)c(=O)[nH]c2=O)C[C@@H]1O)Oc1cccc2ccccc12)C(C)CC |
| InChI | InChI=1S/C30H39FN3O9P/c1-4-6-9-15-40-29(37)27(19(3)5-2)33-44(39,43-24-14-10-12-20-11-7-8-13-21(20)24)41-18-25-23(35)16-26(42-25)34-17-22(31)28(36)32-30(34)38/h7-8,10-14,17,19,23,25-27,35H,4-6,9,15-16,18H2,1-3H3,(H,33,39)(H,32,36,38)/t19?,23-,25+,26+,27-,44?/m0/s1 |
| InChIKey | DJFANKJZPRGUCT-RFWJPACXSA-N |
| XLogP | 4.42 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.63 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|