C23H23F3N4O9 — CID 87172416
2,2,2-trifluoro-N-[3-[4-[1-[[1-[(2S,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]methoxy]ethyl]-3-nitrophenyl]prop-2-ynyl]acetamide (PubChem CID 87172416) has the molecular formula C23H23F3N4O9 and a molecular weight of 556.45 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[3-[4-[1-[[1-[(2S,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]methoxy]ethyl]-3-nitrophenyl]prop-2-ynyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[3-[4-[1-[[1-[(2S,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]methoxy]ethyl]-3-nitrophenyl]prop-2-ynyl]acetamide |
|---|---|
| PubChem CID | 87172416 |
| Molecular Formula | C23H23F3N4O9 |
| Molecular Weight | 556.45 g/mol |
| Exact Mass | 556.14 |
| IUPAC Name | 2,2,2-trifluoro-N-[3-[4-[1-[[1-[(2S,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]methoxy]ethyl]-3-nitrophenyl]prop-2-ynyl]acetamide |
| SMILES | CC(OCc1cn([C@@H]2CC(O)[C@H](CO)O2)c(=O)[nH]c1=O)c1ccc(C#CCNC(=O)C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H23F3N4O9/c1-12(15-5-4-13(7-16(15)30(36)37)3-2-6-27-21(34)23(24,25)26)38-11-14-9-29(22(35)28-20(14)33)19-8-17(32)18(10-31)39-19/h4-5,7,9,12,17-19,31-32H,6,8,10-11H2,1H3,(H,27,34)(H,28,33,35)/t12?,17?,18-,19-/m0/s1 |
| InChIKey | XBMJZNNQZGPBIW-FOLHBFKUSA-N |
| XLogP | 0.39 |
| TPSA | 186.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.45 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|