C20H24IN3O8 — CID 58520479
1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-[[(1S)-1-(4-iodo-2-nitrophenyl)-2-methylpropoxy]methyl]pyrimidine-2,4-dione (PubChem CID 58520479) has the molecular formula C20H24IN3O8 and a molecular weight of 561.33 g/mol. Its IUPAC name is 1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-[[(1S)-1-(4-iodo-2-nitrophenyl)-2-methylpropoxy]methyl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-[[(1S)-1-(4-iodo-2-nitrophenyl)-2-methylpropoxy]methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 58520479 |
| Molecular Formula | C20H24IN3O8 |
| Molecular Weight | 561.33 g/mol |
| Exact Mass | 561.06 |
| IUPAC Name | 1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-[[(1S)-1-(4-iodo-2-nitrophenyl)-2-methylpropoxy]methyl]pyrimidine-2,4-dione |
| SMILES | CC(C)[C@H](OCc1cn([C@H]2CC(O)[C@@H](CO)O2)c(=O)[nH]c1=O)c1ccc(I)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H24IN3O8/c1-10(2)18(13-4-3-12(21)5-14(13)24(29)30)31-9-11-7-23(20(28)22-19(11)27)17-6-15(26)16(8-25)32-17/h3-5,7,10,15-18,25-26H,6,8-9H2,1-2H3,(H,22,27,28)/t15?,16-,17-,18+/m1/s1 |
| InChIKey | VWLFWMUPUJSJNV-KCBNDJSGSA-N |
| XLogP | 1.60 |
| TPSA | 156.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.33 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|