C16H17N3O8 — CID 90663583
1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-[(4-nitrophenoxy)methyl]pyrimidine-2,4-dione (PubChem CID 90663583) has the molecular formula C16H17N3O8 and a molecular weight of 379.33 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-[(4-nitrophenoxy)methyl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-[(4-nitrophenoxy)methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 90663583 |
| Molecular Formula | C16H17N3O8 |
| Molecular Weight | 379.33 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-[(4-nitrophenoxy)methyl]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n([C@H]2C[C@H](O)[C@@H](CO)O2)cc1COc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H17N3O8/c20-7-13-12(21)5-14(27-13)18-6-9(15(22)17-16(18)23)8-26-11-3-1-10(2-4-11)19(24)25/h1-4,6,12-14,20-21H,5,7-8H2,(H,17,22,23)/t12-,13+,14+/m0/s1 |
| InChIKey | UHIXLGFDOXYHRR-BFHYXJOUSA-N |
| XLogP | -0.34 |
| TPSA | 156.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.33 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|