C16H18N3O10P — CID 23519718
[(2R,3S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-[(4-nitrophenoxy)methyl]oxolan-3-yl] dihydrogen phosphate (PubChem CID 23519718) has the molecular formula C16H18N3O10P and a molecular weight of 443.31 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-[(4-nitrophenoxy)methyl]oxolan-3-yl] dihydrogen phosphate.
| Compound Name | [(2R,3S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-[(4-nitrophenoxy)methyl]oxolan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 23519718 |
| Molecular Formula | C16H18N3O10P |
| Molecular Weight | 443.31 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | [(2R,3S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-[(4-nitrophenoxy)methyl]oxolan-3-yl] dihydrogen phosphate |
| SMILES | Cc1cn([C@H]2C[C@H](OP(=O)(O)O)[C@@H](COc3ccc([N+](=O)[O-])cc3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H18N3O10P/c1-9-7-18(16(21)17-15(9)20)14-6-12(29-30(24,25)26)13(28-14)8-27-11-4-2-10(3-5-11)19(22)23/h2-5,7,12-14H,6,8H2,1H3,(H,17,20,21)(H2,24,25,26)/t12-,13+,14+/m0/s1 |
| InChIKey | MSJFYAKVZVMGHG-BFHYXJOUSA-N |
| XLogP | 0.60 |
| TPSA | 183.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.31 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|