C16H17N3O6S2 — CID 59248809
1-[(2R,5R)-5-(hydroxymethyl)-4-[(4-nitrophenyl)disulfanyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 59248809) has the molecular formula C16H17N3O6S2 and a molecular weight of 411.46 g/mol. Its IUPAC name is 1-[(2R,5R)-5-(hydroxymethyl)-4-[(4-nitrophenyl)disulfanyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5R)-5-(hydroxymethyl)-4-[(4-nitrophenyl)disulfanyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 59248809 |
| Molecular Formula | C16H17N3O6S2 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | 1-[(2R,5R)-5-(hydroxymethyl)-4-[(4-nitrophenyl)disulfanyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2CC(SSc3ccc([N+](=O)[O-])cc3)[C@@H](CO)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H17N3O6S2/c1-9-7-18(16(22)17-15(9)21)14-6-13(12(8-20)25-14)27-26-11-4-2-10(3-5-11)19(23)24/h2-5,7,12-14,20H,6,8H2,1H3,(H,17,21,22)/t12-,13?,14-/m1/s1 |
| InChIKey | GNCSKLIHFSFARZ-WYAMFQBQSA-N |
| XLogP | 1.84 |
| TPSA | 127.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|