C16H15N3O7S2 — CID 143565402
1-[(2R)-5-(hydroxymethyl)-4-(4-nitrophenyl)sulfanylsulfinyl-2,3-dihydrofuran-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 143565402) has the molecular formula C16H15N3O7S2 and a molecular weight of 425.44 g/mol. Its IUPAC name is 1-[(2R)-5-(hydroxymethyl)-4-(4-nitrophenyl)sulfanylsulfinyl-2,3-dihydrofuran-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R)-5-(hydroxymethyl)-4-(4-nitrophenyl)sulfanylsulfinyl-2,3-dihydrofuran-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 143565402 |
| Molecular Formula | C16H15N3O7S2 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.04 |
| IUPAC Name | 1-[(2R)-5-(hydroxymethyl)-4-(4-nitrophenyl)sulfanylsulfinyl-2,3-dihydrofuran-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2CC(S(=O)Sc3ccc([N+](=O)[O-])cc3)=C(CO)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H15N3O7S2/c1-9-7-18(16(22)17-15(9)21)14-6-13(12(8-20)26-14)28(25)27-11-4-2-10(3-5-11)19(23)24/h2-5,7,14,20H,6,8H2,1H3,(H,17,21,22)/t14-,28?/m1/s1 |
| InChIKey | JVLZDDNRICFYCA-JZNOQINNSA-N |
| XLogP | 1.33 |
| TPSA | 144.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|