C18H28N2O4S2 — CID 143565398
1-[(2R)-5-(hydroxymethyl)-4-(octyldisulfanyl)-2,3-dihydrofuran-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 143565398) has the molecular formula C18H28N2O4S2 and a molecular weight of 400.57 g/mol. Its IUPAC name is 1-[(2R)-5-(hydroxymethyl)-4-(octyldisulfanyl)-2,3-dihydrofuran-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R)-5-(hydroxymethyl)-4-(octyldisulfanyl)-2,3-dihydrofuran-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 143565398 |
| Molecular Formula | C18H28N2O4S2 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 1-[(2R)-5-(hydroxymethyl)-4-(octyldisulfanyl)-2,3-dihydrofuran-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | CCCCCCCCSSC1=C(CO)O[C@@H](n2cc(C)c(=O)[nH]c2=O)C1 |
| InChI | InChI=1S/C18H28N2O4S2/c1-3-4-5-6-7-8-9-25-26-15-10-16(24-14(15)12-21)20-11-13(2)17(22)19-18(20)23/h11,16,21H,3-10,12H2,1-2H3,(H,19,22,23)/t16-/m1/s1 |
| InChIKey | IVVJPVBPONFPRH-MRXNPFEDSA-N |
| XLogP | 3.71 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|