C24H20N4O11 — CID 134930193
[(2R,3S,5S)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-(4-nitrobenzoyl)oxyoxolan-2-yl]methyl 4-nitrobenzoate (PubChem CID 134930193) has the molecular formula C24H20N4O11 and a molecular weight of 540.44 g/mol. Its IUPAC name is [(2R,3S,5S)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-(4-nitrobenzoyl)oxyoxolan-2-yl]methyl 4-nitrobenzoate.
| Compound Name | [(2R,3S,5S)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-(4-nitrobenzoyl)oxyoxolan-2-yl]methyl 4-nitrobenzoate |
|---|---|
| PubChem CID | 134930193 |
| Molecular Formula | C24H20N4O11 |
| Molecular Weight | 540.44 g/mol |
| Exact Mass | 540.11 |
| IUPAC Name | [(2R,3S,5S)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-(4-nitrobenzoyl)oxyoxolan-2-yl]methyl 4-nitrobenzoate |
| SMILES | Cc1cn([C@@H]2C[C@H](OC(=O)c3ccc([N+](=O)[O-])cc3)[C@@H](COC(=O)c3ccc([N+](=O)[O-])cc3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C24H20N4O11/c1-13-11-26(24(32)25-21(13)29)20-10-18(39-23(31)15-4-8-17(9-5-15)28(35)36)19(38-20)12-37-22(30)14-2-6-16(7-3-14)27(33)34/h2-9,11,18-20H,10,12H2,1H3,(H,25,29,32)/t18-,19+,20-/m0/s1 |
| InChIKey | GNLCLSDPGFCSKH-ZCNNSNEGSA-N |
| XLogP | 2.03 |
| TPSA | 202.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.44 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|