C24H21N3O10 — CID 66783332
1-O-[[(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl] 2-O-(4-nitrophenyl) benzene-1,2-dicarboxylate (PubChem CID 66783332) has the molecular formula C24H21N3O10 and a molecular weight of 511.44 g/mol. Its IUPAC name is 1-O-[[(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl] 2-O-(4-nitrophenyl) benzene-1,2-dicarboxylate.
| Compound Name | 1-O-[[(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl] 2-O-(4-nitrophenyl) benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 66783332 |
| Molecular Formula | C24H21N3O10 |
| Molecular Weight | 511.44 g/mol |
| Exact Mass | 511.12 |
| IUPAC Name | 1-O-[[(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl] 2-O-(4-nitrophenyl) benzene-1,2-dicarboxylate |
| SMILES | Cc1cn([C@H]2C[C@H](O)[C@@H](COC(=O)c3ccccc3C(=O)Oc3ccc([N+](=O)[O-])cc3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C24H21N3O10/c1-13-11-26(24(32)25-21(13)29)20-10-18(28)19(37-20)12-35-22(30)16-4-2-3-5-17(16)23(31)36-15-8-6-14(7-9-15)27(33)34/h2-9,11,18-20,28H,10,12H2,1H3,(H,25,29,32)/t18-,19+,20+/m0/s1 |
| InChIKey | CETHZMVNBLZIAV-XUVXKRRUSA-N |
| XLogP | 1.48 |
| TPSA | 180.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.44 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|