C21H25N3O11 — CID 67675021
2-(4,5-dimethoxy-2-nitrophenyl)ethyl [(2R,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl carbonate (PubChem CID 67675021) has the molecular formula C21H25N3O11 and a molecular weight of 495.44 g/mol. Its IUPAC name is 2-(4,5-dimethoxy-2-nitrophenyl)ethyl [(2R,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl carbonate.
| Compound Name | 2-(4,5-dimethoxy-2-nitrophenyl)ethyl [(2R,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl carbonate |
|---|---|
| PubChem CID | 67675021 |
| Molecular Formula | C21H25N3O11 |
| Molecular Weight | 495.44 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | 2-(4,5-dimethoxy-2-nitrophenyl)ethyl [(2R,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl carbonate |
| SMILES | COc1cc(CCOC(=O)OC[C@H]2O[C@@H](n3cc(C)c(=O)[nH]c3=O)CC2O)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C21H25N3O11/c1-11-9-23(20(27)22-19(11)26)18-8-14(25)17(35-18)10-34-21(28)33-5-4-12-6-15(31-2)16(32-3)7-13(12)24(29)30/h6-7,9,14,17-18,25H,4-5,8,10H2,1-3H3,(H,22,26,27)/t14?,17-,18-/m1/s1 |
| InChIKey | VLPFYJJLCWZGJF-KNHHTTPFSA-N |
| XLogP | 0.81 |
| TPSA | 181.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.44 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|