C19H19Cl2N3O9 — CID 15289340
2-(2,4-dichloro-6-nitrophenyl)ethyl [(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl carbonate (PubChem CID 15289340) has the molecular formula C19H19Cl2N3O9 and a molecular weight of 504.28 g/mol. Its IUPAC name is 2-(2,4-dichloro-6-nitrophenyl)ethyl [(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl carbonate.
| Compound Name | 2-(2,4-dichloro-6-nitrophenyl)ethyl [(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl carbonate |
|---|---|
| PubChem CID | 15289340 |
| Molecular Formula | C19H19Cl2N3O9 |
| Molecular Weight | 504.28 g/mol |
| Exact Mass | 503.05 |
| IUPAC Name | 2-(2,4-dichloro-6-nitrophenyl)ethyl [(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl carbonate |
| SMILES | Cc1cn([C@H]2C[C@H](O)[C@@H](COC(=O)OCCc3c(Cl)cc(Cl)cc3[N+](=O)[O-])O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H19Cl2N3O9/c1-9-7-23(18(27)22-17(9)26)16-6-14(25)15(33-16)8-32-19(28)31-3-2-11-12(21)4-10(20)5-13(11)24(29)30/h4-5,7,14-16,25H,2-3,6,8H2,1H3,(H,22,26,27)/t14-,15+,16+/m0/s1 |
| InChIKey | GKJZZXKDSIOQIM-ARFHVFGLSA-N |
| XLogP | 2.10 |
| TPSA | 162.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|