C14H20N2O7S — CID 162427207
[(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 2-methylsulfanylethyl carbonate (PubChem CID 162427207) has the molecular formula C14H20N2O7S and a molecular weight of 360.39 g/mol. Its IUPAC name is [(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 2-methylsulfanylethyl carbonate.
| Compound Name | [(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 2-methylsulfanylethyl carbonate |
|---|---|
| PubChem CID | 162427207 |
| Molecular Formula | C14H20N2O7S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | [(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 2-methylsulfanylethyl carbonate |
| SMILES | CSCCOC(=O)OC[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)C[C@@H]1O |
| InChI | InChI=1S/C14H20N2O7S/c1-8-6-16(13(19)15-12(8)18)11-5-9(17)10(23-11)7-22-14(20)21-3-4-24-2/h6,9-11,17H,3-5,7H2,1-2H3,(H,15,18,19)/t9-,10+,11+/m0/s1 |
| InChIKey | ANSCGHZGELNYKI-HBNTYKKESA-N |
| XLogP | 0.01 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|