C19H21N3O10 — CID 70152107
[(2R,5R)-3,4-dihydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 2-(2-nitrophenyl)ethyl carbonate (PubChem CID 70152107) has the molecular formula C19H21N3O10 and a molecular weight of 451.39 g/mol. Its IUPAC name is [(2R,5R)-3,4-dihydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 2-(2-nitrophenyl)ethyl carbonate.
| Compound Name | [(2R,5R)-3,4-dihydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 2-(2-nitrophenyl)ethyl carbonate |
|---|---|
| PubChem CID | 70152107 |
| Molecular Formula | C19H21N3O10 |
| Molecular Weight | 451.39 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | [(2R,5R)-3,4-dihydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 2-(2-nitrophenyl)ethyl carbonate |
| SMILES | Cc1cn([C@@H]2O[C@H](COC(=O)OCCc3ccccc3[N+](=O)[O-])C(O)C2O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H21N3O10/c1-10-8-21(18(26)20-16(10)25)17-15(24)14(23)13(32-17)9-31-19(27)30-7-6-11-4-2-3-5-12(11)22(28)29/h2-5,8,13-15,17,23-24H,6-7,9H2,1H3,(H,20,25,26)/t13-,14?,15?,17-/m1/s1 |
| InChIKey | DOGVICXGPBALHD-ARAOSMHQSA-N |
| XLogP | -0.23 |
| TPSA | 183.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.39 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|