C16H27N3O7 — CID 69251849
1-[(2R,3R,4S,5R)-5-[2-[2-(dimethylamino)ethoxy]ethoxymethyl]-3,4-dihydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 69251849) has the molecular formula C16H27N3O7 and a molecular weight of 373.41 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-5-[2-[2-(dimethylamino)ethoxy]ethoxymethyl]-3,4-dihydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5R)-5-[2-[2-(dimethylamino)ethoxy]ethoxymethyl]-3,4-dihydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 69251849 |
| Molecular Formula | C16H27N3O7 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-5-[2-[2-(dimethylamino)ethoxy]ethoxymethyl]-3,4-dihydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@@H]2O[C@H](COCCOCCN(C)C)[C@@H](O)[C@H]2O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H27N3O7/c1-10-8-19(16(23)17-14(10)22)15-13(21)12(20)11(26-15)9-25-7-6-24-5-4-18(2)3/h8,11-13,15,20-21H,4-7,9H2,1-3H3,(H,17,22,23)/t11-,12-,13-,15-/m1/s1 |
| InChIKey | NHCBQFQLYGGFRR-RGCMKSIDSA-N |
| XLogP | -1.94 |
| TPSA | 126.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|