C19H20ClN3O10 — CID 70153070
2-(2-chloro-6-nitrophenyl)ethyl [(2R,5R)-4-hydroxy-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] carbonate (PubChem CID 70153070) has the molecular formula C19H20ClN3O10 and a molecular weight of 485.83 g/mol. Its IUPAC name is 2-(2-chloro-6-nitrophenyl)ethyl [(2R,5R)-4-hydroxy-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] carbonate.
| Compound Name | 2-(2-chloro-6-nitrophenyl)ethyl [(2R,5R)-4-hydroxy-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] carbonate |
|---|---|
| PubChem CID | 70153070 |
| Molecular Formula | C19H20ClN3O10 |
| Molecular Weight | 485.83 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | 2-(2-chloro-6-nitrophenyl)ethyl [(2R,5R)-4-hydroxy-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] carbonate |
| SMILES | Cc1cn([C@@H]2O[C@H](CO)C(OC(=O)OCCc3c(Cl)cccc3[N+](=O)[O-])C2O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H20ClN3O10/c1-9-7-22(18(27)21-16(9)26)17-14(25)15(13(8-24)32-17)33-19(28)31-6-5-10-11(20)3-2-4-12(10)23(29)30/h2-4,7,13-15,17,24-25H,5-6,8H2,1H3,(H,21,26,27)/t13-,14?,15?,17-/m1/s1 |
| InChIKey | LUERVACVMHPUNE-ARAOSMHQSA-N |
| XLogP | 0.42 |
| TPSA | 183.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.83 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|