C13H19N3O7 — CID 121487370
1-[(2R,3R,5S)-5-(hydroxymethyl)-4-nitro-3-propoxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 121487370) has the molecular formula C13H19N3O7 and a molecular weight of 329.31 g/mol. Its IUPAC name is 1-[(2R,3R,5S)-5-(hydroxymethyl)-4-nitro-3-propoxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,5S)-5-(hydroxymethyl)-4-nitro-3-propoxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 121487370 |
| Molecular Formula | C13H19N3O7 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 1-[(2R,3R,5S)-5-(hydroxymethyl)-4-nitro-3-propoxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | CCCO[C@@H]1C([N+](=O)[O-])[C@@H](CO)O[C@H]1n1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H19N3O7/c1-3-4-22-10-9(16(20)21)8(6-17)23-12(10)15-5-7(2)11(18)14-13(15)19/h5,8-10,12,17H,3-4,6H2,1-2H3,(H,14,18,19)/t8-,9?,10-,12-/m1/s1 |
| InChIKey | CNZWQCYBVRUZLE-FJJXIOPLSA-N |
| XLogP | -0.82 |
| TPSA | 136.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|