C16H21N3O9 — CID 10476044
2-[(2R,3R,4R,5S)-5-(acetyloxymethyl)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-4-nitrooxolan-3-yl]ethyl acetate (PubChem CID 10476044) has the molecular formula C16H21N3O9 and a molecular weight of 399.36 g/mol. Its IUPAC name is 2-[(2R,3R,4R,5S)-5-(acetyloxymethyl)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-4-nitrooxolan-3-yl]ethyl acetate.
| Compound Name | 2-[(2R,3R,4R,5S)-5-(acetyloxymethyl)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-4-nitrooxolan-3-yl]ethyl acetate |
|---|---|
| PubChem CID | 10476044 |
| Molecular Formula | C16H21N3O9 |
| Molecular Weight | 399.36 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 2-[(2R,3R,4R,5S)-5-(acetyloxymethyl)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-4-nitrooxolan-3-yl]ethyl acetate |
| SMILES | CC(=O)OCC[C@@H]1[C@@H]([N+](=O)[O-])[C@@H](COC(C)=O)O[C@H]1n1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H21N3O9/c1-8-6-18(16(23)17-14(8)22)15-11(4-5-26-9(2)20)13(19(24)25)12(28-15)7-27-10(3)21/h6,11-13,15H,4-5,7H2,1-3H3,(H,17,22,23)/t11-,12-,13-,15-/m1/s1 |
| InChIKey | OWQHGCXAPVJESC-RGCMKSIDSA-N |
| XLogP | -0.48 |
| TPSA | 159.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.36 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|