C31H24N6O15 — CID 124937323
[(2R,3R,4S,6S)-6-(6-methyl-3,5-dioxo-1,2,4-triazin-2-yl)-3,4-bis[(4-nitrobenzoyl)oxy]oxan-2-yl]methyl 4-nitrobenzoate (PubChem CID 124937323) has the molecular formula C31H24N6O15 and a molecular weight of 720.56 g/mol. Its IUPAC name is [(2R,3R,4S,6S)-6-(6-methyl-3,5-dioxo-1,2,4-triazin-2-yl)-3,4-bis[(4-nitrobenzoyl)oxy]oxan-2-yl]methyl 4-nitrobenzoate.
| Compound Name | [(2R,3R,4S,6S)-6-(6-methyl-3,5-dioxo-1,2,4-triazin-2-yl)-3,4-bis[(4-nitrobenzoyl)oxy]oxan-2-yl]methyl 4-nitrobenzoate |
|---|---|
| PubChem CID | 124937323 |
| Molecular Formula | C31H24N6O15 |
| Molecular Weight | 720.56 g/mol |
| Exact Mass | 720.13 |
| IUPAC Name | [(2R,3R,4S,6S)-6-(6-methyl-3,5-dioxo-1,2,4-triazin-2-yl)-3,4-bis[(4-nitrobenzoyl)oxy]oxan-2-yl]methyl 4-nitrobenzoate |
| SMILES | Cc1nn([C@@H]2C[C@H](OC(=O)c3ccc([N+](=O)[O-])cc3)[C@@H](OC(=O)c3ccc([N+](=O)[O-])cc3)[C@@H](COC(=O)c3ccc([N+](=O)[O-])cc3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C31H24N6O15/c1-16-27(38)32-31(42)34(33-16)25-14-23(51-29(40)18-4-10-21(11-5-18)36(45)46)26(52-30(41)19-6-12-22(13-7-19)37(47)48)24(50-25)15-49-28(39)17-2-8-20(9-3-17)35(43)44/h2-13,23-26H,14-15H2,1H3,(H,32,38,42)/t23-,24+,25-,26+/m0/s1 |
| InChIKey | MIFXJGYIGLJNNL-ROXDYWFKSA-N |
| XLogP | 2.56 |
| TPSA | 285.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.56 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|