C25H25N3O7 — CID 15612836
[(2R,3S,5S)-3-(4-methylbenzoyl)oxy-5-(6-methyl-3,5-dioxo-1,2,4-triazin-2-yl)oxolan-2-yl]methyl 4-methylbenzoate (PubChem CID 15612836) has the molecular formula C25H25N3O7 and a molecular weight of 479.49 g/mol. Its IUPAC name is [(2R,3S,5S)-3-(4-methylbenzoyl)oxy-5-(6-methyl-3,5-dioxo-1,2,4-triazin-2-yl)oxolan-2-yl]methyl 4-methylbenzoate.
| Compound Name | [(2R,3S,5S)-3-(4-methylbenzoyl)oxy-5-(6-methyl-3,5-dioxo-1,2,4-triazin-2-yl)oxolan-2-yl]methyl 4-methylbenzoate |
|---|---|
| PubChem CID | 15612836 |
| Molecular Formula | C25H25N3O7 |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | [(2R,3S,5S)-3-(4-methylbenzoyl)oxy-5-(6-methyl-3,5-dioxo-1,2,4-triazin-2-yl)oxolan-2-yl]methyl 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OC[C@H]2O[C@H](n3nc(C)c(=O)[nH]c3=O)C[C@@H]2OC(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H25N3O7/c1-14-4-8-17(9-5-14)23(30)33-13-20-19(35-24(31)18-10-6-15(2)7-11-18)12-21(34-20)28-25(32)26-22(29)16(3)27-28/h4-11,19-21H,12-13H2,1-3H3,(H,26,29,32)/t19-,20+,21-/m0/s1 |
| InChIKey | AKMGTHWBBFIKGM-HBMCJLEFSA-N |
| XLogP | 2.23 |
| TPSA | 129.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |