C18H21N4O10PS2 — CID 10460168
[(2R,3S,5R)-3-[(2,4-dinitrophenyl)disulfanyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl dimethyl phosphite (PubChem CID 10460168) has the molecular formula C18H21N4O10PS2 and a molecular weight of 548.49 g/mol. Its IUPAC name is [(2R,3S,5R)-3-[(2,4-dinitrophenyl)disulfanyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl dimethyl phosphite.
| Compound Name | [(2R,3S,5R)-3-[(2,4-dinitrophenyl)disulfanyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl dimethyl phosphite |
|---|---|
| PubChem CID | 10460168 |
| Molecular Formula | C18H21N4O10PS2 |
| Molecular Weight | 548.49 g/mol |
| Exact Mass | 548.04 |
| IUPAC Name | [(2R,3S,5R)-3-[(2,4-dinitrophenyl)disulfanyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl dimethyl phosphite |
| SMILES | COP(OC)OC[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)C[C@@H]1SSc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H21N4O10PS2/c1-10-8-20(18(24)19-17(10)23)16-7-15(13(32-16)9-31-33(29-2)30-3)35-34-14-5-4-11(21(25)26)6-12(14)22(27)28/h4-6,8,13,15-16H,7,9H2,1-3H3,(H,19,23,24)/t13-,15+,16-/m1/s1 |
| InChIKey | KBWUFXLYWTZCFI-VNQPRFMTSA-N |
| XLogP | 3.29 |
| TPSA | 178.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|