C13H20N2O4S2 — CID 71159001
1-[(2R,4R,5R)-5-(hydroxymethyl)-4-(2-methylsulfanylethylsulfanyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 71159001) has the molecular formula C13H20N2O4S2 and a molecular weight of 332.45 g/mol. Its IUPAC name is 1-[(2R,4R,5R)-5-(hydroxymethyl)-4-(2-methylsulfanylethylsulfanyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4R,5R)-5-(hydroxymethyl)-4-(2-methylsulfanylethylsulfanyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 71159001 |
| Molecular Formula | C13H20N2O4S2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 1-[(2R,4R,5R)-5-(hydroxymethyl)-4-(2-methylsulfanylethylsulfanyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | CSCCS[C@@H]1C[C@H](n2cc(C)c(=O)[nH]c2=O)O[C@@H]1CO |
| InChI | InChI=1S/C13H20N2O4S2/c1-8-6-15(13(18)14-12(8)17)11-5-10(9(7-16)19-11)21-4-3-20-2/h6,9-11,16H,3-5,7H2,1-2H3,(H,14,17,18)/t9-,10-,11-/m1/s1 |
| InChIKey | VDCBMDPYLWGLHS-GMTAPVOTSA-N |
| XLogP | 0.59 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|