C20H24N3O12P — CID 101155945
[(2R,3S,5R)-2-[(2-acetyl-4-methoxy-3-nitrophenyl)methoxymethyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] dihydrogen phosphate (PubChem CID 101155945) has the molecular formula C20H24N3O12P and a molecular weight of 529.40 g/mol. Its IUPAC name is [(2R,3S,5R)-2-[(2-acetyl-4-methoxy-3-nitrophenyl)methoxymethyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] dihydrogen phosphate.
| Compound Name | [(2R,3S,5R)-2-[(2-acetyl-4-methoxy-3-nitrophenyl)methoxymethyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 101155945 |
| Molecular Formula | C20H24N3O12P |
| Molecular Weight | 529.40 g/mol |
| Exact Mass | 529.11 |
| IUPAC Name | [(2R,3S,5R)-2-[(2-acetyl-4-methoxy-3-nitrophenyl)methoxymethyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] dihydrogen phosphate |
| SMILES | COc1ccc(COC[C@H]2O[C@@H](n3cc(C)c(=O)[nH]c3=O)C[C@@H]2OP(=O)(O)O)c(C(C)=O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H24N3O12P/c1-10-7-22(20(26)21-19(10)25)16-6-14(35-36(29,30)31)15(34-16)9-33-8-12-4-5-13(32-3)18(23(27)28)17(12)11(2)24/h4-5,7,14-16H,6,8-9H2,1-3H3,(H,21,25,26)(H2,29,30,31)/t14-,15+,16+/m0/s1 |
| InChIKey | YOQVRFUQCWWABO-ARFHVFGLSA-N |
| XLogP | 0.95 |
| TPSA | 209.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.40 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|