C24H31N6O11P — CID 136864073
[(2R,3S,5R)-2-[(2-acetyl-4-methoxy-3-nitrophenyl)methoxymethyl]-5-[2-(2-methylpropylamino)-6-oxo-1H-purin-9-yl]oxolan-3-yl] dihydrogen phosphate (PubChem CID 136864073) has the molecular formula C24H31N6O11P and a molecular weight of 610.52 g/mol. Its IUPAC name is [(2R,3S,5R)-2-[(2-acetyl-4-methoxy-3-nitrophenyl)methoxymethyl]-5-[2-(2-methylpropylamino)-6-oxo-1H-purin-9-yl]oxolan-3-yl] dihydrogen phosphate.
| Compound Name | [(2R,3S,5R)-2-[(2-acetyl-4-methoxy-3-nitrophenyl)methoxymethyl]-5-[2-(2-methylpropylamino)-6-oxo-1H-purin-9-yl]oxolan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 136864073 |
| Molecular Formula | C24H31N6O11P |
| Molecular Weight | 610.52 g/mol |
| Exact Mass | 610.18 |
| IUPAC Name | [(2R,3S,5R)-2-[(2-acetyl-4-methoxy-3-nitrophenyl)methoxymethyl]-5-[2-(2-methylpropylamino)-6-oxo-1H-purin-9-yl]oxolan-3-yl] dihydrogen phosphate |
| SMILES | COc1ccc(COC[C@H]2O[C@@H](n3cnc4c(=O)[nH]c(NCC(C)C)nc43)C[C@@H]2OP(=O)(O)O)c(C(C)=O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C24H31N6O11P/c1-12(2)8-25-24-27-22-20(23(32)28-24)26-11-29(22)18-7-16(41-42(35,36)37)17(40-18)10-39-9-14-5-6-15(38-4)21(30(33)34)19(14)13(3)31/h5-6,11-12,16-18H,7-10H2,1-4H3,(H2,35,36,37)(H2,25,27,28,32)/t16-,17+,18+/m0/s1 |
| InChIKey | YTTZRUGKUGWZSL-RCCFBDPRSA-N |
| XLogP | 2.29 |
| TPSA | 230.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.52 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|