C12H18N5O6P — CID 136630273
[5-(2-amino-6-oxo-1H-purin-9-yl)-2-(methoxymethyl)oxolan-3-yl]oxy-methylphosphinic acid (PubChem CID 136630273) has the molecular formula C12H18N5O6P and a molecular weight of 359.28 g/mol. Its IUPAC name is [5-(2-amino-6-oxo-1H-purin-9-yl)-2-(methoxymethyl)oxolan-3-yl]oxy-methylphosphinic acid.
| Compound Name | [5-(2-amino-6-oxo-1H-purin-9-yl)-2-(methoxymethyl)oxolan-3-yl]oxy-methylphosphinic acid |
|---|---|
| PubChem CID | 136630273 |
| Molecular Formula | C12H18N5O6P |
| Molecular Weight | 359.28 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | [5-(2-amino-6-oxo-1H-purin-9-yl)-2-(methoxymethyl)oxolan-3-yl]oxy-methylphosphinic acid |
| SMILES | COCC1OC(n2cnc3c(=O)[nH]c(N)nc32)CC1OP(C)(=O)O |
| InChI | InChI=1S/C12H18N5O6P/c1-21-4-7-6(23-24(2,19)20)3-8(22-7)17-5-14-9-10(17)15-12(13)16-11(9)18/h5-8H,3-4H2,1-2H3,(H,19,20)(H3,13,15,16,18) |
| InChIKey | RWPMTZSJILJVDF-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 154.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.28 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|