C13H18N2O5Se — CID 140614758
5-(cyclopropylselanylmethyl)-1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 140614758) has the molecular formula C13H18N2O5Se and a molecular weight of 361.26 g/mol. Its IUPAC name is 5-(cyclopropylselanylmethyl)-1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-(cyclopropylselanylmethyl)-1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 140614758 |
| Molecular Formula | C13H18N2O5Se |
| Molecular Weight | 361.26 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | 5-(cyclopropylselanylmethyl)-1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n([C@H]2CC(O)[C@@H](CO)O2)cc1C[Se]C1CC1 |
| InChI | InChI=1S/C13H18N2O5Se/c16-5-10-9(17)3-11(20-10)15-4-7(6-21-8-1-2-8)12(18)14-13(15)19/h4,8-11,16-17H,1-3,5-6H2,(H,14,18,19)/t9?,10-,11-/m1/s1 |
| InChIKey | RAGGJZNWTGYHAG-FHZGLPGMSA-N |
| XLogP | -1.04 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.26 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|