C17H20N2O5Se — CID 159817123
1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-[(4-methylphenyl)selanylmethyl]pyrimidine-2,4-dione (PubChem CID 159817123) has the molecular formula C17H20N2O5Se and a molecular weight of 411.32 g/mol. Its IUPAC name is 1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-[(4-methylphenyl)selanylmethyl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-[(4-methylphenyl)selanylmethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 159817123 |
| Molecular Formula | C17H20N2O5Se |
| Molecular Weight | 411.32 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | 1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-[(4-methylphenyl)selanylmethyl]pyrimidine-2,4-dione |
| SMILES | Cc1ccc([Se]Cc2cn([C@H]3CC(O)[C@@H](CO)O3)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C17H20N2O5Se/c1-10-2-4-12(5-3-10)25-9-11-7-19(17(23)18-16(11)22)15-6-13(21)14(8-20)24-15/h2-5,7,13-15,20-21H,6,8-9H2,1H3,(H,18,22,23)/t13?,14-,15-/m1/s1 |
| InChIKey | UHYQAYVRLSTNOO-JVIGXAJISA-N |
| XLogP | -0.98 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.32 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|