C13H20N2O5Se — CID 140614756
1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(propan-2-ylselanylmethyl)pyrimidine-2,4-dione (PubChem CID 140614756) has the molecular formula C13H20N2O5Se and a molecular weight of 363.27 g/mol. Its IUPAC name is 1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(propan-2-ylselanylmethyl)pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(propan-2-ylselanylmethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 140614756 |
| Molecular Formula | C13H20N2O5Se |
| Molecular Weight | 363.27 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(propan-2-ylselanylmethyl)pyrimidine-2,4-dione |
| SMILES | CC(C)[Se]Cc1cn([C@H]2CC(O)[C@@H](CO)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H20N2O5Se/c1-7(2)21-6-8-4-15(13(19)14-12(8)18)11-3-9(17)10(5-16)20-11/h4,7,9-11,16-17H,3,5-6H2,1-2H3,(H,14,18,19)/t9?,10-,11-/m1/s1 |
| InChIKey | UXUZDEPSUBNPSO-FHZGLPGMSA-N |
| XLogP | -0.79 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.27 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|