C20H21F3N4O9 — CID 88967462
2,2,2-trifluoro-N-[[4-[[1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]methoxymethyl]-3-nitrophenyl]methyl]acetamide (PubChem CID 88967462) has the molecular formula C20H21F3N4O9 and a molecular weight of 518.40 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[[4-[[1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]methoxymethyl]-3-nitrophenyl]methyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[[4-[[1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]methoxymethyl]-3-nitrophenyl]methyl]acetamide |
|---|---|
| PubChem CID | 88967462 |
| Molecular Formula | C20H21F3N4O9 |
| Molecular Weight | 518.40 g/mol |
| Exact Mass | 518.13 |
| IUPAC Name | 2,2,2-trifluoro-N-[[4-[[1-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]methoxymethyl]-3-nitrophenyl]methyl]acetamide |
| SMILES | O=C(NCc1ccc(COCc2cn([C@H]3CC(O)[C@@H](CO)O3)c(=O)[nH]c2=O)c([N+](=O)[O-])c1)C(F)(F)F |
| InChI | InChI=1S/C20H21F3N4O9/c21-20(22,23)18(31)24-5-10-1-2-11(13(3-10)27(33)34)8-35-9-12-6-26(19(32)25-17(12)30)16-4-14(29)15(7-28)36-16/h1-3,6,14-16,28-29H,4-5,7-9H2,(H,24,31)(H,25,30,32)/t14?,15-,16-/m1/s1 |
| InChIKey | YEJIDFUCYSKDOC-ANGDWKNPSA-N |
| XLogP | -0.02 |
| TPSA | 186.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.40 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|