C13H16F3N3O6S — CID 88873047
2,2,2-trifluoro-N-[[1-[5-(hydroxymethyl)-4-(sulfanylmethoxy)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]methyl]acetamide (PubChem CID 88873047) has the molecular formula C13H16F3N3O6S and a molecular weight of 399.35 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[[1-[5-(hydroxymethyl)-4-(sulfanylmethoxy)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]methyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[[1-[5-(hydroxymethyl)-4-(sulfanylmethoxy)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 88873047 |
| Molecular Formula | C13H16F3N3O6S |
| Molecular Weight | 399.35 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 2,2,2-trifluoro-N-[[1-[5-(hydroxymethyl)-4-(sulfanylmethoxy)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]methyl]acetamide |
| SMILES | O=C(NCc1cn(C2CC(OCS)C(CO)O2)c(=O)[nH]c1=O)C(F)(F)F |
| InChI | InChI=1S/C13H16F3N3O6S/c14-13(15,16)11(22)17-2-6-3-19(12(23)18-10(6)21)9-1-7(24-5-26)8(4-20)25-9/h3,7-9,20,26H,1-2,4-5H2,(H,17,22)(H,18,21,23) |
| InChIKey | QJQKWULHGCVOIR-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 122.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.35 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|