C17H20F3N3O6 — CID 171608106
2,2,2-trifluoro-N-[(E)-3-[1-[(2R,4R,5R)-5-(hydroxymethyl)-4-prop-2-enoxyoxolan-2-yl]-2,4-dioxopyrimidin-5-yl]prop-2-enyl]acetamide (PubChem CID 171608106) has the molecular formula C17H20F3N3O6 and a molecular weight of 419.36 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(E)-3-[1-[(2R,4R,5R)-5-(hydroxymethyl)-4-prop-2-enoxyoxolan-2-yl]-2,4-dioxopyrimidin-5-yl]prop-2-enyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(E)-3-[1-[(2R,4R,5R)-5-(hydroxymethyl)-4-prop-2-enoxyoxolan-2-yl]-2,4-dioxopyrimidin-5-yl]prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 171608106 |
| Molecular Formula | C17H20F3N3O6 |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 2,2,2-trifluoro-N-[(E)-3-[1-[(2R,4R,5R)-5-(hydroxymethyl)-4-prop-2-enoxyoxolan-2-yl]-2,4-dioxopyrimidin-5-yl]prop-2-enyl]acetamide |
| SMILES | C=CCO[C@@H]1C[C@H](n2cc(/C=C/CNC(=O)C(F)(F)F)c(=O)[nH]c2=O)O[C@@H]1CO |
| InChI | InChI=1S/C17H20F3N3O6/c1-2-6-28-11-7-13(29-12(11)9-24)23-8-10(14(25)22-16(23)27)4-3-5-21-15(26)17(18,19)20/h2-4,8,11-13,24H,1,5-7,9H2,(H,21,26)(H,22,25,27)/b4-3+/t11-,12-,13-/m1/s1 |
| InChIKey | ZOSJOVYRIVDPDB-ZUEAMBOYSA-N |
| XLogP | 0.08 |
| TPSA | 122.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|