C19H26F3N5O7 — CID 87172321
(E)-3-[1-[(2S,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]-N-[2-[methyl-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]amino]ethyl]prop-2-enamide (PubChem CID 87172321) has the molecular formula C19H26F3N5O7 and a molecular weight of 493.44 g/mol. Its IUPAC name is (E)-3-[1-[(2S,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]-N-[2-[methyl-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]amino]ethyl]prop-2-enamide.
| Compound Name | (E)-3-[1-[(2S,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]-N-[2-[methyl-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]amino]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 87172321 |
| Molecular Formula | C19H26F3N5O7 |
| Molecular Weight | 493.44 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | (E)-3-[1-[(2S,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]-N-[2-[methyl-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]amino]ethyl]prop-2-enamide |
| SMILES | CN(CCNC(=O)/C=C/c1cn([C@@H]2CC(O)[C@H](CO)O2)c(=O)[nH]c1=O)CCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C19H26F3N5O7/c1-26(7-5-24-17(32)19(20,21)22)6-4-23-14(30)3-2-11-9-27(18(33)25-16(11)31)15-8-12(29)13(10-28)34-15/h2-3,9,12-13,15,28-29H,4-8,10H2,1H3,(H,23,30)(H,24,32)(H,25,31,33)/b3-2+/t12?,13-,15-/m0/s1 |
| InChIKey | GZPRXCNSCFZREN-WVEBTWFWSA-N |
| XLogP | -2.08 |
| TPSA | 165.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.44 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|